About dilithium;2-amino-2-oxidoacetate
dilithium;2-amino-2-oxidoacetate (PubChem CID 56968278) has the molecular formula C2H3Li2NO3
and a molecular weight of 102.93 g/mol. Its IUPAC name is dilithium;2-amino-2-oxidoacetate.
Molecular Properties
| Compound Name | dilithium;2-amino-2-oxidoacetate |
| PubChem CID | 56968278 |
| Molecular Formula | C2H3Li2NO3 |
| Molecular Weight | 102.93 g/mol |
| Exact Mass | 103.04 |
| IUPAC Name | dilithium;2-amino-2-oxidoacetate |
| SMILES | NC([O-])C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C2H4NO3.2Li/c3-1(4)2(5)6;;/h1H,3H2,(H,5,6);;/q-1;2*+1/p-1 |
| InChIKey | HAPLWARNDFTJKK-UHFFFAOYSA-M |
| XLogP | -9.61 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.93 |
| LogP ≤ 5 | -9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-amino-2-oxidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-amino-2-oxidoacetate?
The IUPAC name of dilithium;2-amino-2-oxidoacetate (CID 56968278) is dilithium;2-amino-2-oxidoacetate.
What is the SMILES notation for dilithium;2-amino-2-oxidoacetate?
The canonical SMILES for dilithium;2-amino-2-oxidoacetate is NC([O-])C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;2-amino-2-oxidoacetate?
The InChIKey is HAPLWARNDFTJKK-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4NO3.2Li/c3-1(4)2(5)6;;/h1H,3H2,(H,5,6);;/q-1;2*+1/p-1.
What are the key properties of dilithium;2-amino-2-oxidoacetate?
dilithium;2-amino-2-oxidoacetate has a molecular weight of 102.93 g/mol, XLogP of -9.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-amino-2-oxidoacetate is sourced from PubChem (CID 56968278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).