About bis(2,2-dichloroacetate);iron(2+)
bis(2,2-dichloroacetate);iron(2+) (PubChem CID 18984297) has the molecular formula C4H2Cl4FeO4
and a molecular weight of 311.71 g/mol. Its IUPAC name is bis(2,2-dichloroacetate);iron(2+).
Molecular Properties
| Compound Name | bis(2,2-dichloroacetate);iron(2+) |
| PubChem CID | 18984297 |
| Molecular Formula | C4H2Cl4FeO4 |
| Molecular Weight | 311.71 g/mol |
| Exact Mass | 309.81 |
| IUPAC Name | bis(2,2-dichloroacetate);iron(2+) |
| SMILES | O=C([O-])C(Cl)Cl.O=C([O-])C(Cl)Cl.[Fe+2] |
| InChI | InChI=1S/2C2H2Cl2O2.Fe/c2*3-1(4)2(5)6;/h2*1H,(H,5,6);/q;;+2/p-2 |
| InChIKey | OMNBPDHMPNCYHI-UHFFFAOYSA-L |
| XLogP | -0.92 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.71 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2-dichloroacetate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dichloroacetate);iron(2+)?
The IUPAC name of bis(2,2-dichloroacetate);iron(2+) (CID 18984297) is bis(2,2-dichloroacetate);iron(2+).
What is the SMILES notation for bis(2,2-dichloroacetate);iron(2+)?
The canonical SMILES for bis(2,2-dichloroacetate);iron(2+) is O=C([O-])C(Cl)Cl.O=C([O-])C(Cl)Cl.[Fe+2].
What is the InChIKey of bis(2,2-dichloroacetate);iron(2+)?
The InChIKey is OMNBPDHMPNCYHI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H2Cl2O2.Fe/c2*3-1(4)2(5)6;/h2*1H,(H,5,6);/q;;+2/p-2.
What are the key properties of bis(2,2-dichloroacetate);iron(2+)?
bis(2,2-dichloroacetate);iron(2+) has a molecular weight of 311.71 g/mol, XLogP of -0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dichloroacetate);iron(2+) is sourced from PubChem (CID 18984297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).