About calcium bis(2,2-dichloroacetate)
calcium bis(2,2-dichloroacetate) (PubChem CID 56953502) has the molecular formula C4H2CaCl4O4
and a molecular weight of 295.95 g/mol. Its IUPAC name is calcium bis(2,2-dichloroacetate).
Molecular Properties
| Compound Name | calcium bis(2,2-dichloroacetate) |
| PubChem CID | 56953502 |
| Molecular Formula | C4H2CaCl4O4 |
| Molecular Weight | 295.95 g/mol |
| Exact Mass | 293.83 |
| IUPAC Name | calcium bis(2,2-dichloroacetate) |
| SMILES | O=C([O-])C(Cl)Cl.O=C([O-])C(Cl)Cl.[Ca+2] |
| InChI | InChI=1S/2C2H2Cl2O2.Ca/c2*3-1(4)2(5)6;/h2*1H,(H,5,6);/q;;+2/p-2 |
| InChIKey | CIIDPHGZSTZHSG-UHFFFAOYSA-L |
| XLogP | -1.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.95 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(2,2-dichloroacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(2,2-dichloroacetate)?
The IUPAC name of calcium bis(2,2-dichloroacetate) (CID 56953502) is calcium bis(2,2-dichloroacetate).
What is the SMILES notation for calcium bis(2,2-dichloroacetate)?
The canonical SMILES for calcium bis(2,2-dichloroacetate) is O=C([O-])C(Cl)Cl.O=C([O-])C(Cl)Cl.[Ca+2].
What is the InChIKey of calcium bis(2,2-dichloroacetate)?
The InChIKey is CIIDPHGZSTZHSG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H2Cl2O2.Ca/c2*3-1(4)2(5)6;/h2*1H,(H,5,6);/q;;+2/p-2.
What are the key properties of calcium bis(2,2-dichloroacetate)?
calcium bis(2,2-dichloroacetate) has a molecular weight of 295.95 g/mol, XLogP of -1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(2,2-dichloroacetate) is sourced from PubChem (CID 56953502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).