About calcium 2-bromopropanedioate
calcium 2-bromopropanedioate (PubChem CID 153352123) has the molecular formula C3HBrCaO4
and a molecular weight of 221.02 g/mol. Its IUPAC name is calcium 2-bromopropanedioate.
Molecular Properties
| Compound Name | calcium 2-bromopropanedioate |
| PubChem CID | 153352123 |
| Molecular Formula | C3HBrCaO4 |
| Molecular Weight | 221.02 g/mol |
| Exact Mass | 219.87 |
| IUPAC Name | calcium 2-bromopropanedioate |
| SMILES | O=C([O-])C(Br)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C3H3BrO4.Ca/c4-1(2(5)6)3(7)8;/h1H,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | BNBZSDHDLGTUFU-UHFFFAOYSA-L |
| XLogP | -3.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.02 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze calcium 2-bromopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium 2-bromopropanedioate?
The IUPAC name of calcium 2-bromopropanedioate (CID 153352123) is calcium 2-bromopropanedioate.
What is the SMILES notation for calcium 2-bromopropanedioate?
The canonical SMILES for calcium 2-bromopropanedioate is O=C([O-])C(Br)C(=O)[O-].[Ca+2].
What is the InChIKey of calcium 2-bromopropanedioate?
The InChIKey is BNBZSDHDLGTUFU-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H3BrO4.Ca/c4-1(2(5)6)3(7)8;/h1H,(H,5,6)(H,7,8);/q;+2/p-2.
What are the key properties of calcium 2-bromopropanedioate?
calcium 2-bromopropanedioate has a molecular weight of 221.02 g/mol, XLogP of -3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium 2-bromopropanedioate is sourced from PubChem (CID 153352123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).