C4H2Br2O4-2 — CID 6992600
(2S,3S)-2,3-dibromobutanedioate (PubChem CID 6992600) has the molecular formula C4H2Br2O4-2 and a molecular weight of 273.86 g/mol. Its IUPAC name is (2S,3S)-2,3-dibromobutanedioate.
| Compound Name | (2S,3S)-2,3-dibromobutanedioate |
|---|---|
| PubChem CID | 6992600 |
| Molecular Formula | C4H2Br2O4-2 |
| Molecular Weight | 273.86 g/mol |
| Exact Mass | 271.83 |
| IUPAC Name | (2S,3S)-2,3-dibromobutanedioate |
| SMILES | O=C([O-])[C@H](Br)[C@@H](Br)C(=O)[O-] |
| InChI | InChI=1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2-/m1/s1 |
| InChIKey | FJWGRXKOBIVTFA-JCYAYHJZSA-L |
| XLogP | -1.99 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.86 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|