About strontium;palladium;carbonate
strontium;palladium;carbonate (PubChem CID 87283579) has the molecular formula CO3PdSr
and a molecular weight of 254.05 g/mol. Its IUPAC name is strontium;palladium;carbonate.
Molecular Properties
| Compound Name | strontium;palladium;carbonate |
| PubChem CID | 87283579 |
| Molecular Formula | CO3PdSr |
| Molecular Weight | 254.05 g/mol |
| Exact Mass | 253.79 |
| IUPAC Name | strontium;palladium;carbonate |
| SMILES | O=C([O-])[O-].[Pd].[Sr+2] |
| InChI | InChI=1S/CH2O3.Pd.Sr/c2-1(3)4;;/h(H2,2,3,4);;/q;;+2/p-2 |
| InChIKey | QIGBQTOFLXSGFD-UHFFFAOYSA-L |
| XLogP | -2.83 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.05 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze strontium;palladium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;palladium;carbonate?
The IUPAC name of strontium;palladium;carbonate (CID 87283579) is strontium;palladium;carbonate.
What is the SMILES notation for strontium;palladium;carbonate?
The canonical SMILES for strontium;palladium;carbonate is O=C([O-])[O-].[Pd].[Sr+2].
What is the InChIKey of strontium;palladium;carbonate?
The InChIKey is QIGBQTOFLXSGFD-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Pd.Sr/c2-1(3)4;;/h(H2,2,3,4);;/q;;+2/p-2.
What are the key properties of strontium;palladium;carbonate?
strontium;palladium;carbonate has a molecular weight of 254.05 g/mol, XLogP of -2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;palladium;carbonate is sourced from PubChem (CID 87283579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).