About strontium;methane;carbonate
strontium;methane;carbonate (PubChem CID 174760201) has the molecular formula C2H4O3Sr
and a molecular weight of 163.67 g/mol. Its IUPAC name is strontium;methane;carbonate.
Molecular Properties
| Compound Name | strontium;methane;carbonate |
| PubChem CID | 174760201 |
| Molecular Formula | C2H4O3Sr |
| Molecular Weight | 163.67 g/mol |
| Exact Mass | 163.92 |
| IUPAC Name | strontium;methane;carbonate |
| SMILES | C.O=C([O-])[O-].[Sr+2] |
| InChI | InChI=1S/CH2O3.CH4.Sr/c2-1(3)4;;/h(H2,2,3,4);1H4;/q;;+2/p-2 |
| InChIKey | IUIZUEHEPJLKKT-UHFFFAOYSA-L |
| XLogP | -2.19 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.67 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze strontium;methane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;methane;carbonate?
The IUPAC name of strontium;methane;carbonate (CID 174760201) is strontium;methane;carbonate.
What is the SMILES notation for strontium;methane;carbonate?
The canonical SMILES for strontium;methane;carbonate is C.O=C([O-])[O-].[Sr+2].
What is the InChIKey of strontium;methane;carbonate?
The InChIKey is IUIZUEHEPJLKKT-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.CH4.Sr/c2-1(3)4;;/h(H2,2,3,4);1H4;/q;;+2/p-2.
What are the key properties of strontium;methane;carbonate?
strontium;methane;carbonate has a molecular weight of 163.67 g/mol, XLogP of -2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;methane;carbonate is sourced from PubChem (CID 174760201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).