C4H4BrF3NO2- — CID 150737358
(2S,3S)-3-amino-2-bromo-4,4,4-trifluorobutanoate (PubChem CID 150737358) has the molecular formula C4H4BrF3NO2- and a molecular weight of 234.98 g/mol. Its IUPAC name is (2S,3S)-3-amino-2-bromo-4,4,4-trifluorobutanoate.
| Compound Name | (2S,3S)-3-amino-2-bromo-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 150737358 |
| Molecular Formula | C4H4BrF3NO2- |
| Molecular Weight | 234.98 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | (2S,3S)-3-amino-2-bromo-4,4,4-trifluorobutanoate |
| SMILES | N[C@H]([C@H](Br)C(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C4H5BrF3NO2/c5-1(3(10)11)2(9)4(6,7)8/h1-2H,9H2,(H,10,11)/p-1/t1-,2+/m0/s1 |
| InChIKey | JTCBJCUNYNYHMB-NHYDCYSISA-M |
| XLogP | -0.61 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.98 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|