C3H2F3O3- — CID 7457722
(2S)-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 7457722) has the molecular formula C3H2F3O3- and a molecular weight of 143.04 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | (2S)-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 7457722 |
| Molecular Formula | C3H2F3O3- |
| Molecular Weight | 143.04 g/mol |
| Exact Mass | 143.00 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | O=C([O-])[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C3H3F3O3/c4-3(5,6)1(7)2(8)9/h1,7H,(H,8,9)/p-1/t1-/m0/s1 |
| InChIKey | BVKGUTLIPHZYCX-SFOWXEAESA-M |
| XLogP | -1.34 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.04 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |