C5H6Li2O7 — CID 140580978
dilithium;(2R,4S)-2,3,4-trihydroxypentanedioate (PubChem CID 140580978) has the molecular formula C5H6Li2O7 and a molecular weight of 191.98 g/mol. Its IUPAC name is dilithium;(2R,4S)-2,3,4-trihydroxypentanedioate.
| Compound Name | dilithium;(2R,4S)-2,3,4-trihydroxypentanedioate |
|---|---|
| PubChem CID | 140580978 |
| Molecular Formula | C5H6Li2O7 |
| Molecular Weight | 191.98 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | dilithium;(2R,4S)-2,3,4-trihydroxypentanedioate |
| SMILES | O=C([O-])[C@@H](O)C(O)[C@@H](O)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C5H8O7.2Li/c6-1(2(7)4(9)10)3(8)5(11)12;;/h1-3,6-8H,(H,9,10)(H,11,12);;/q;2*+1/p-2/t1?,2-,3+;; |
| InChIKey | GDWQDAHWVCRHHY-MLFDNCOYSA-L |
| XLogP | -11.42 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.98 |
| LogP ≤ 5 | -11.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |