C6H8O8-2 — CID 5288393
(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 5288393) has the molecular formula C6H8O8-2 and a molecular weight of 208.12 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 5288393 |
| Molecular Formula | C6H8O8-2 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/p-2/t1-,2-,3-,4+/m0/s1 |
| InChIKey | DSLZVSRJTYRBFB-LLEIAEIESA-L |
| XLogP | -6.07 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |