C6H9KO8 — CID 23674495
potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate (PubChem CID 23674495) has the molecular formula C6H9KO8 and a molecular weight of 248.23 g/mol. Its IUPAC name is potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate.
| Compound Name | potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 23674495 |
| Molecular Formula | C6H9KO8 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C6H10O8.K/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+1/p-1/t1-,2-,3-,4+;/m0./s1 |
| InChIKey | UBYZGUWQNIEQMH-SBBOJQDXSA-M |
| XLogP | -7.73 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -7.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |