potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate

C6H9KO8 — CID 23674495

IUPACpotassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate
SMILESO=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[K+]
InChIInChI=1S/C6H10O8.K/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+1/p-1/t1-,2-,3-,4+;/m0./s1
InChIKeyUBYZGUWQNIEQMH-SBBOJQDXSA-M
MW248.23 g/mol
LogP-7.73
Rot. Bonds5

About potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate

potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate (PubChem CID 23674495) has the molecular formula C6H9KO8 and a molecular weight of 248.23 g/mol. Its IUPAC name is potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate.

Molecular Properties

Compound Namepotassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate
PubChem CID23674495
Molecular FormulaC6H9KO8
Molecular Weight248.23 g/mol
Exact Mass247.99
IUPAC Namepotassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate
SMILESO=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[K+]
InChIInChI=1S/C6H10O8.K/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+1/p-1/t1-,2-,3-,4+;/m0./s1
InChIKeyUBYZGUWQNIEQMH-SBBOJQDXSA-M
XLogP-7.73
TPSA158.35 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.23
LogP ≤ 5-7.73
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Analyze potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate?
The IUPAC name of potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate (CID 23674495) is potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate.
What is the SMILES notation for potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate?
The canonical SMILES for potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate is O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[K+].
What is the InChIKey of potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate?
The InChIKey is UBYZGUWQNIEQMH-SBBOJQDXSA-M. The full InChI is InChI=1S/C6H10O8.K/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+1/p-1/t1-,2-,3-,4+;/m0./s1.
What are the key properties of potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate?
potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate has a molecular weight of 248.23 g/mol, XLogP of -7.73, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate is sourced from PubChem (CID 23674495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).