C6H8CaO8 — CID 54675058
calcium (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 54675058) has the molecular formula C6H8CaO8 and a molecular weight of 248.20 g/mol. Its IUPAC name is calcium (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | calcium (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 54675058 |
| Molecular Formula | C6H8CaO8 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | calcium (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C6H10O8.Ca/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+2/p-2/t1-,2+,3-,4+; |
| InChIKey | UGZVNIRNPPEDHM-VAIQDEORSA-L |
| XLogP | -6.45 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | -6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |