C6H8LiNaO8 — CID 140580975
lithium;sodium;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 140580975) has the molecular formula C6H8LiNaO8 and a molecular weight of 238.05 g/mol. Its IUPAC name is lithium;sodium;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | lithium;sodium;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 140580975 |
| Molecular Formula | C6H8LiNaO8 |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | lithium;sodium;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | O=C([O-])[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[Li+].[Na+] |
| InChI | InChI=1S/C6H10O8.Li.Na/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;;/h1-4,7-10H,(H,11,12)(H,13,14);;/q;2*+1/p-2/t1-,2+,3+,4-;; |
| InChIKey | OWJPLJXFFICCEM-SXKXKJGMSA-L |
| XLogP | -12.06 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | -12.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |