C12H16O16Tc — CID 159200130
technetium(4+);bis((2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate) (PubChem CID 159200130) has the molecular formula C12H16O16Tc and a molecular weight of 514.24 g/mol. Its IUPAC name is technetium(4+);bis((2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate).
| Compound Name | technetium(4+);bis((2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate) |
|---|---|
| PubChem CID | 159200130 |
| Molecular Formula | C12H16O16Tc |
| Molecular Weight | 514.24 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | technetium(4+);bis((2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate) |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[Tc+4] |
| InChI | InChI=1S/2C6H10O8.Tc/c2*7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h2*1-4,7-10H,(H,11,12)(H,13,14);/q;;+4/p-4/t2*1-,2-,3-,4+;/m00./s1 |
| InChIKey | KPEIQXMVJTXIKL-OQPYWUJXSA-J |
| XLogP | -12.14 |
| TPSA | 322.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.24 |
| LogP ≤ 5 | -12.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |