C6H11KO6 — CID 101160606
potassium (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoate (PubChem CID 101160606) has the molecular formula C6H11KO6 and a molecular weight of 218.25 g/mol. Its IUPAC name is potassium (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoate.
| Compound Name | potassium (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 101160606 |
| Molecular Formula | C6H11KO6 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | potassium (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoate |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C6H12O6.K/c1-2(7)3(8)4(9)5(10)6(11)12;/h2-5,7-10H,1H3,(H,11,12);/q;+1/p-1/t2-,3+,4+,5-;/m0./s1 |
| InChIKey | IVRCKVJFDZEDSO-RMTXHFLUSA-M |
| XLogP | -6.80 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |