C6H9KO8 — CID 19073829
potassium;hydron;2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 19073829) has the molecular formula C6H9KO8 and a molecular weight of 248.23 g/mol. Its IUPAC name is potassium;hydron;2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | potassium;hydron;2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 19073829 |
| Molecular Formula | C6H9KO8 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | potassium;hydron;2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | O=C([O-])C(O)C(O)C(O)C(O)C(=O)[O-].[H+].[K+] |
| InChI | InChI=1S/C6H10O8.K/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+1/p-1 |
| InChIKey | UBYZGUWQNIEQMH-UHFFFAOYSA-M |
| XLogP | -8.95 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -8.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |