C6H10O8 — CID 6857454
(2S,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid (PubChem CID 6857454) has the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid.
| Compound Name | (2S,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid |
|---|---|
| PubChem CID | 6857454 |
| Molecular Formula | C6H10O8 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (2S,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3-,4-/m0/s1 |
| InChIKey | DSLZVSRJTYRBFB-YCAKELIYSA-N |
| XLogP | -3.40 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |