C6H9BrO7 — CID 141336053
(2S,3S,4S,5R)-6-bromo-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 141336053) has the molecular formula C6H9BrO7 and a molecular weight of 273.04 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-bromo-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2S,3S,4S,5R)-6-bromo-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 141336053 |
| Molecular Formula | C6H9BrO7 |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | (2S,3S,4S,5R)-6-bromo-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)Br |
| InChI | InChI=1S/C6H9BrO7/c7-5(12)3(10)1(8)2(9)4(11)6(13)14/h1-4,8-11H,(H,13,14)/t1-,2-,3+,4-/m0/s1 |
| InChIKey | SXJFNHVQSAMVDR-QDQPNEQZSA-N |
| XLogP | -2.56 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|