C6H13AlCuO8 — CID 175292865
alumane;copper;2,3,4,5-tetrahydroxyhexanedioic acid (PubChem CID 175292865) has the molecular formula C6H13AlCuO8 and a molecular weight of 303.69 g/mol. Its IUPAC name is alumane;copper;2,3,4,5-tetrahydroxyhexanedioic acid.
| Compound Name | alumane;copper;2,3,4,5-tetrahydroxyhexanedioic acid |
|---|---|
| PubChem CID | 175292865 |
| Molecular Formula | C6H13AlCuO8 |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | alumane;copper;2,3,4,5-tetrahydroxyhexanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)C(=O)O.[AlH3].[Cu] |
| InChI | InChI=1S/C6H10O8.Al.Cu.3H/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;;;;;/h1-4,7-10H,(H,11,12)(H,13,14);;;;; |
| InChIKey | QVNMUCPWIDSYSO-UHFFFAOYSA-N |
| XLogP | -4.59 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |