C6H13NO8 — CID 90473080
azane;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid (PubChem CID 90473080) has the molecular formula C6H13NO8 and a molecular weight of 227.17 g/mol. Its IUPAC name is azane;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid.
| Compound Name | azane;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
|---|---|
| PubChem CID | 90473080 |
| Molecular Formula | C6H13NO8 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | azane;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
| SMILES | N.O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O8.H3N/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);1H3/t1-,2+,3+,4-; |
| InChIKey | JLIUVUHOBNCPMC-UEXKISHTSA-N |
| XLogP | -3.24 |
| TPSA | 190.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |