C6H11NO7 — CID 167483909
(2S,3S,4R,5S)-6-amino-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 167483909) has the molecular formula C6H11NO7 and a molecular weight of 209.15 g/mol. Its IUPAC name is (2S,3S,4R,5S)-6-amino-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2S,3S,4R,5S)-6-amino-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 167483909 |
| Molecular Formula | C6H11NO7 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2S,3S,4R,5S)-6-amino-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | NC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H11NO7/c7-5(12)3(10)1(8)2(9)4(11)6(13)14/h1-4,8-11H,(H2,7,12)(H,13,14)/t1-,2+,3+,4+/m1/s1 |
| InChIKey | OZRCMOFRVFRZQV-HTVIOJJOSA-N |
| XLogP | -4.00 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |