(2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid

C5H11NO5 — CID 135189043

IUPAC(2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid
SMILESNC[C@H](O)[C@@H](O)[C@H](O)C(=O)O
InChIInChI=1S/C5H11NO5/c6-1-2(7)3(8)4(9)5(10)11/h2-4,7-9H,1,6H2,(H,10,11)/t2-,3+,4-/m0/s1
InChIKeyHTLCITWVEYLCKJ-NUNKFHFFSA-N
MW165.14 g/mol
LogP-2.89
Rot. Bonds4

About (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid

(2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid (PubChem CID 135189043) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid.

Molecular Properties

Compound Name(2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid
PubChem CID135189043
Molecular FormulaC5H11NO5
Molecular Weight165.14 g/mol
Exact Mass165.06
IUPAC Name(2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid
SMILESNC[C@H](O)[C@@H](O)[C@H](O)C(=O)O
InChIInChI=1S/C5H11NO5/c6-1-2(7)3(8)4(9)5(10)11/h2-4,7-9H,1,6H2,(H,10,11)/t2-,3+,4-/m0/s1
InChIKeyHTLCITWVEYLCKJ-NUNKFHFFSA-N
XLogP-2.89
TPSA124.01 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.14
LogP ≤ 5-2.89
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid?
The IUPAC name of (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid (CID 135189043) is (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid.
What is the SMILES notation for (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid?
The canonical SMILES for (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid is NC[C@H](O)[C@@H](O)[C@H](O)C(=O)O.
What is the InChIKey of (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid?
The InChIKey is HTLCITWVEYLCKJ-NUNKFHFFSA-N. The full InChI is InChI=1S/C5H11NO5/c6-1-2(7)3(8)4(9)5(10)11/h2-4,7-9H,1,6H2,(H,10,11)/t2-,3+,4-/m0/s1.
What are the key properties of (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid?
(2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid has a molecular weight of 165.14 g/mol, XLogP of -2.89, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R,4S)-5-amino-2,3,4-trihydroxypentanoic acid is sourced from PubChem (CID 135189043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).