C19H38N2O23 — CID 159377313
diazanium;bis((2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid (PubChem CID 159377313) has the molecular formula C19H38N2O23 and a molecular weight of 662.50 g/mol. Its IUPAC name is diazanium;bis((2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid.
| Compound Name | diazanium;bis((2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 159377313 |
| Molecular Formula | C19H38N2O23 |
| Molecular Weight | 662.50 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | diazanium;bis((2R,3S,4S,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid |
| SMILES | CC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O.O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C7H12O7.2C6H10O8.2H3N/c1-2(8)3(9)4(10)5(11)6(12)7(13)14;2*7-1(3(9)5(11)12)2(8)4(10)6(13)14;;/h3-6,9-12H,1H3,(H,13,14);2*1-4,7-10H,(H,11,12)(H,13,14);2*1H3/t3-,4+,5-,6-;2*1-,2-,3-,4+;;/m000../s1 |
| InChIKey | WZXDGZFJOXDAIJ-FFKAWROFSA-N |
| XLogP | -11.61 |
| TPSA | 524.99 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.50 |
| LogP ≤ 5 | -11.61 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 20 |