C12H21NaO15 — CID 174890484
sodium;2,3,4,5,6-pentahydroxyhexanoate;2,3,4,5-tetrahydroxyhexanedioic acid (PubChem CID 174890484) has the molecular formula C12H21NaO15 and a molecular weight of 428.28 g/mol. Its IUPAC name is sodium;2,3,4,5,6-pentahydroxyhexanoate;2,3,4,5-tetrahydroxyhexanedioic acid.
| Compound Name | sodium;2,3,4,5,6-pentahydroxyhexanoate;2,3,4,5-tetrahydroxyhexanedioic acid |
|---|---|
| PubChem CID | 174890484 |
| Molecular Formula | C12H21NaO15 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanoate;2,3,4,5-tetrahydroxyhexanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)C(=O)O.O=C([O-])C(O)C(O)C(O)C(O)CO.[Na+] |
| InChI | InChI=1S/C6H10O8.C6H12O7.Na/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;7-1-2(8)3(9)4(10)5(11)6(12)13;/h1-4,7-10H,(H,11,12)(H,13,14);2-5,7-11H,1H2,(H,12,13);/q;;+1/p-1 |
| InChIKey | PHGZXIDLNRXQBT-UHFFFAOYSA-M |
| XLogP | -11.22 |
| TPSA | 296.80 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | -11.22 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |