C5H8F3NO2 — CID 6992670
(2S,3S)-2-azaniumyl-4,4,4-trifluoro-3-methylbutanoate (PubChem CID 6992670) has the molecular formula C5H8F3NO2 and a molecular weight of 171.12 g/mol. Its IUPAC name is (2S,3S)-2-azaniumyl-4,4,4-trifluoro-3-methylbutanoate.
| Compound Name | (2S,3S)-2-azaniumyl-4,4,4-trifluoro-3-methylbutanoate |
|---|---|
| PubChem CID | 6992670 |
| Molecular Formula | C5H8F3NO2 |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (2S,3S)-2-azaniumyl-4,4,4-trifluoro-3-methylbutanoate |
| SMILES | C[C@@H]([C@H]([NH3+])C(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2/c1-2(5(6,7)8)3(9)4(10)11/h2-3H,9H2,1H3,(H,10,11)/t2-,3-/m0/s1 |
| InChIKey | BAOLXXJPOPIBKA-HRFVKAFMSA-N |
| XLogP | -1.45 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |