C10H13NO2 — CID 6951461
(2R,3R)-2-azaniumyl-3-phenylbutanoate (PubChem CID 6951461) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2R,3R)-2-azaniumyl-3-phenylbutanoate.
| Compound Name | (2R,3R)-2-azaniumyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 6951461 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2R,3R)-2-azaniumyl-3-phenylbutanoate |
| SMILES | C[C@H](c1ccccc1)[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C10H13NO2/c1-7(9(11)10(12)13)8-5-3-2-4-6-8/h2-7,9H,11H2,1H3,(H,12,13)/t7-,9-/m1/s1 |
| InChIKey | IRZQDMYEJPNDEN-VXNVDRBHSA-N |
| XLogP | -0.85 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |