About (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate
(2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate (PubChem CID 7345418) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate.
Molecular Properties
| Compound Name | (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate |
| PubChem CID | 7345418 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate |
| SMILES | [NH3+][C@H](C(=O)[O-])[C@H](c1ccccc1)C(F)F |
| InChI | InChI=1S/C10H11F2NO2/c11-9(12)7(8(13)10(14)15)6-4-2-1-3-5-6/h1-5,7-9H,13H2,(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | UVFHYDJXZVRKFN-YUMQZZPRSA-N |
| XLogP | -0.60 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate?
The IUPAC name of (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate (CID 7345418) is (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate.
What is the SMILES notation for (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate?
The canonical SMILES for (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate is [NH3+][C@H](C(=O)[O-])[C@H](c1ccccc1)C(F)F.
What is the InChIKey of (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate?
The InChIKey is UVFHYDJXZVRKFN-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H11F2NO2/c11-9(12)7(8(13)10(14)15)6-4-2-1-3-5-6/h1-5,7-9H,13H2,(H,14,15)/t7-,8-/m0/s1.
What are the key properties of (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate?
(2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate has a molecular weight of 215.20 g/mol, XLogP of -0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-azaniumyl-4,4-difluoro-3-phenylbutanoate is sourced from PubChem (CID 7345418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).