About potassium 2-chloro-2-phenylacetate
potassium 2-chloro-2-phenylacetate (PubChem CID 23694408) has the molecular formula C8H6ClKO2
and a molecular weight of 208.69 g/mol. Its IUPAC name is potassium 2-chloro-2-phenylacetate.
Molecular Properties
| Compound Name | potassium 2-chloro-2-phenylacetate |
| PubChem CID | 23694408 |
| Molecular Formula | C8H6ClKO2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | potassium 2-chloro-2-phenylacetate |
| SMILES | O=C([O-])C(Cl)c1ccccc1.[K+] |
| InChI | InChI=1S/C8H7ClO2.K/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7H,(H,10,11);/q;+1/p-1 |
| InChIKey | DZHLPMFPMYOBFQ-UHFFFAOYSA-M |
| XLogP | -2.28 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-chloro-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-chloro-2-phenylacetate?
The IUPAC name of potassium 2-chloro-2-phenylacetate (CID 23694408) is potassium 2-chloro-2-phenylacetate.
What is the SMILES notation for potassium 2-chloro-2-phenylacetate?
The canonical SMILES for potassium 2-chloro-2-phenylacetate is O=C([O-])C(Cl)c1ccccc1.[K+].
What is the InChIKey of potassium 2-chloro-2-phenylacetate?
The InChIKey is DZHLPMFPMYOBFQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7ClO2.K/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7H,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 2-chloro-2-phenylacetate?
potassium 2-chloro-2-phenylacetate has a molecular weight of 208.69 g/mol, XLogP of -2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-chloro-2-phenylacetate is sourced from PubChem (CID 23694408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).