C14H9ClF2O — CID 81235854
2-chloro-1-(2,6-difluorophenyl)-2-phenylethanone (PubChem CID 81235854) has the molecular formula C14H9ClF2O and a molecular weight of 266.67 g/mol. Its IUPAC name is 2-chloro-1-(2,6-difluorophenyl)-2-phenylethanone.
| Compound Name | 2-chloro-1-(2,6-difluorophenyl)-2-phenylethanone |
|---|---|
| PubChem CID | 81235854 |
| Molecular Formula | C14H9ClF2O |
| Molecular Weight | 266.67 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-chloro-1-(2,6-difluorophenyl)-2-phenylethanone |
| SMILES | O=C(c1c(F)cccc1F)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H9ClF2O/c15-13(9-5-2-1-3-6-9)14(18)12-10(16)7-4-8-11(12)17/h1-8,13H |
| InChIKey | AWZUSJXWEYBOMD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|