C12H13ClO3 — CID 87705902
1-chloro-6-hydroxy-1-phenylhexane-2,3-dione (PubChem CID 87705902) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is 1-chloro-6-hydroxy-1-phenylhexane-2,3-dione.
| Compound Name | 1-chloro-6-hydroxy-1-phenylhexane-2,3-dione |
|---|---|
| PubChem CID | 87705902 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-chloro-6-hydroxy-1-phenylhexane-2,3-dione |
| SMILES | O=C(CCCO)C(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H13ClO3/c13-11(9-5-2-1-3-6-9)12(16)10(15)7-4-8-14/h1-3,5-6,11,14H,4,7-8H2 |
| InChIKey | UDBOTGHKBRIJER-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|