C18H18O3 — CID 69126030
6-hydroxy-1,1-diphenylhexane-2,3-dione (PubChem CID 69126030) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-hydroxy-1,1-diphenylhexane-2,3-dione.
| Compound Name | 6-hydroxy-1,1-diphenylhexane-2,3-dione |
|---|---|
| PubChem CID | 69126030 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-hydroxy-1,1-diphenylhexane-2,3-dione |
| SMILES | O=C(CCCO)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18O3/c19-13-7-12-16(20)18(21)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,17,19H,7,12-13H2 |
| InChIKey | YGYYUOLHWFAZNX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|