About 5-phenylnonanedioic acid
5-phenylnonanedioic acid (PubChem CID 54103206) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-phenylnonanedioic acid.
Molecular Properties
| Compound Name | 5-phenylnonanedioic acid |
| PubChem CID | 54103206 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5-phenylnonanedioic acid |
| SMILES | O=C(O)CCCC(CCCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H20O4/c16-14(17)10-4-8-13(9-5-11-15(18)19)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,16,17)(H,18,19) |
| InChIKey | NBYOUTITEXEZTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenylnonanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylnonanedioic acid?
The IUPAC name of 5-phenylnonanedioic acid (CID 54103206) is 5-phenylnonanedioic acid.
What is the SMILES notation for 5-phenylnonanedioic acid?
The canonical SMILES for 5-phenylnonanedioic acid is O=C(O)CCCC(CCCC(=O)O)c1ccccc1.
What is the InChIKey of 5-phenylnonanedioic acid?
The InChIKey is NBYOUTITEXEZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c16-14(17)10-4-8-13(9-5-11-15(18)19)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,16,17)(H,18,19).
What are the key properties of 5-phenylnonanedioic acid?
5-phenylnonanedioic acid has a molecular weight of 264.32 g/mol, XLogP of 3.28, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylnonanedioic acid is sourced from PubChem (CID 54103206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).