About 6-phenyloct-7-enoic acid
6-phenyloct-7-enoic acid (PubChem CID 118941596) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-phenyloct-7-enoic acid.
Molecular Properties
| Compound Name | 6-phenyloct-7-enoic acid |
| PubChem CID | 118941596 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-phenyloct-7-enoic acid |
| SMILES | C=CC(CCCCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-2-12(8-6-7-11-14(15)16)13-9-4-3-5-10-13/h2-5,9-10,12H,1,6-8,11H2,(H,15,16) |
| InChIKey | HPCZAGXHRZHDCH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyloct-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyloct-7-enoic acid?
The IUPAC name of 6-phenyloct-7-enoic acid (CID 118941596) is 6-phenyloct-7-enoic acid.
What is the SMILES notation for 6-phenyloct-7-enoic acid?
The canonical SMILES for 6-phenyloct-7-enoic acid is C=CC(CCCCC(=O)O)c1ccccc1.
What is the InChIKey of 6-phenyloct-7-enoic acid?
The InChIKey is HPCZAGXHRZHDCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-12(8-6-7-11-14(15)16)13-9-4-3-5-10-13/h2-5,9-10,12H,1,6-8,11H2,(H,15,16).
What are the key properties of 6-phenyloct-7-enoic acid?
6-phenyloct-7-enoic acid has a molecular weight of 218.30 g/mol, XLogP of 3.60, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyloct-7-enoic acid is sourced from PubChem (CID 118941596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).