(9R)-9-hydroxyundec-10-enoic acid

C11H20O3 — CID 24874221

IUPAC(9R)-9-hydroxyundec-10-enoic acid
SMILESC=C[C@H](O)CCCCCCCC(=O)O
InChIInChI=1S/C11H20O3/c1-2-10(12)8-6-4-3-5-7-9-11(13)14/h2,10,12H,1,3-9H2,(H,13,14)/t10-/m0/s1
InChIKeyCJUFNYIRKDOQMC-JTQLQIEISA-N
MW200.28 g/mol
LogP2.35
Rot. Bonds9

About (9R)-9-hydroxyundec-10-enoic acid

(9R)-9-hydroxyundec-10-enoic acid (PubChem CID 24874221) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (9R)-9-hydroxyundec-10-enoic acid.

Molecular Properties

Compound Name(9R)-9-hydroxyundec-10-enoic acid
PubChem CID24874221
Molecular FormulaC11H20O3
Molecular Weight200.28 g/mol
Exact Mass200.14
IUPAC Name(9R)-9-hydroxyundec-10-enoic acid
SMILESC=C[C@H](O)CCCCCCCC(=O)O
InChIInChI=1S/C11H20O3/c1-2-10(12)8-6-4-3-5-7-9-11(13)14/h2,10,12H,1,3-9H2,(H,13,14)/t10-/m0/s1
InChIKeyCJUFNYIRKDOQMC-JTQLQIEISA-N
XLogP2.35
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 52.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (9R)-9-hydroxyundec-10-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(9S)-9-hydroxyundec-10-enoic acid
CID 73242170
2-ethenyltetradecanedioic acid
CID 87751362
2-ethenyltridecanedioic acid
CID 87254012
oct-1-en-3-ol;propanoic acid
CID 57351786
7,8-dihydroxyhexadecanedioic acid
CID 14556981
buta-1,3-diene;decanedioic acid
CID 87614862
(E)-7,10,18-trihydroxyoctadec-8-enoic acid
CID 146242215
5-hydroxytridecanedioic acid
CID 139805426
decanedioic acid;prop-2-enoic acid
CID 87433899
(E,10R,13S)-10,13-dihydroxyicos-11-enoic acid
CID 10020286
(E,8R,11S)-8,11-dihydroxyoctadec-9-enoic acid
CID 10448375
(Z)-7,10-dihydroxyoctadec-8-enoic acid
CID 56776194

Frequently Asked Questions

What is the IUPAC name of (9R)-9-hydroxyundec-10-enoic acid?
The IUPAC name of (9R)-9-hydroxyundec-10-enoic acid (CID 24874221) is (9R)-9-hydroxyundec-10-enoic acid.
What is the SMILES notation for (9R)-9-hydroxyundec-10-enoic acid?
The canonical SMILES for (9R)-9-hydroxyundec-10-enoic acid is C=C[C@H](O)CCCCCCCC(=O)O.
What is the InChIKey of (9R)-9-hydroxyundec-10-enoic acid?
The InChIKey is CJUFNYIRKDOQMC-JTQLQIEISA-N. The full InChI is InChI=1S/C11H20O3/c1-2-10(12)8-6-4-3-5-7-9-11(13)14/h2,10,12H,1,3-9H2,(H,13,14)/t10-/m0/s1.
What are the key properties of (9R)-9-hydroxyundec-10-enoic acid?
(9R)-9-hydroxyundec-10-enoic acid has a molecular weight of 200.28 g/mol, XLogP of 2.35, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-9-hydroxyundec-10-enoic acid is sourced from PubChem (CID 24874221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).