oct-1-en-3-ol;propanoic acid

C11H22O3 — CID 57351786

IUPACoct-1-en-3-ol;propanoic acid
SMILESC=CC(O)CCCCC.CCC(=O)O
InChIInChI=1S/C8H16O.C3H6O2/c1-3-5-6-7-8(9)4-2;1-2-3(4)5/h4,8-9H,2-3,5-7H2,1H3;2H2,1H3,(H,4,5)
InChIKeyXGPRWCKIMRYAKD-UHFFFAOYSA-N
MW202.29 g/mol
LogP2.59
Rot. Bonds6

About oct-1-en-3-ol;propanoic acid

oct-1-en-3-ol;propanoic acid (PubChem CID 57351786) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is oct-1-en-3-ol;propanoic acid.

Molecular Properties

Compound Nameoct-1-en-3-ol;propanoic acid
PubChem CID57351786
Molecular FormulaC11H22O3
Molecular Weight202.29 g/mol
Exact Mass202.16
IUPAC Nameoct-1-en-3-ol;propanoic acid
SMILESC=CC(O)CCCCC.CCC(=O)O
InChIInChI=1S/C8H16O.C3H6O2/c1-3-5-6-7-8(9)4-2;1-2-3(4)5/h4,8-9H,2-3,5-7H2,1H3;2H2,1H3,(H,4,5)
InChIKeyXGPRWCKIMRYAKD-UHFFFAOYSA-N
XLogP2.59
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.29
LogP ≤ 52.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze oct-1-en-3-ol;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oct-1-en-3-ol;propanoic acid?
The IUPAC name of oct-1-en-3-ol;propanoic acid (CID 57351786) is oct-1-en-3-ol;propanoic acid.
What is the SMILES notation for oct-1-en-3-ol;propanoic acid?
The canonical SMILES for oct-1-en-3-ol;propanoic acid is C=CC(O)CCCCC.CCC(=O)O.
What is the InChIKey of oct-1-en-3-ol;propanoic acid?
The InChIKey is XGPRWCKIMRYAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C3H6O2/c1-3-5-6-7-8(9)4-2;1-2-3(4)5/h4,8-9H,2-3,5-7H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of oct-1-en-3-ol;propanoic acid?
oct-1-en-3-ol;propanoic acid has a molecular weight of 202.29 g/mol, XLogP of 2.59, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-en-3-ol;propanoic acid is sourced from PubChem (CID 57351786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).