About oct-1-en-3-ol;propanoic acid
oct-1-en-3-ol;propanoic acid (PubChem CID 57351786) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is oct-1-en-3-ol;propanoic acid.
Molecular Properties
| Compound Name | oct-1-en-3-ol;propanoic acid |
| PubChem CID | 57351786 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | oct-1-en-3-ol;propanoic acid |
| SMILES | C=CC(O)CCCCC.CCC(=O)O |
| InChI | InChI=1S/C8H16O.C3H6O2/c1-3-5-6-7-8(9)4-2;1-2-3(4)5/h4,8-9H,2-3,5-7H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | XGPRWCKIMRYAKD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-1-en-3-ol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-en-3-ol;propanoic acid?
The IUPAC name of oct-1-en-3-ol;propanoic acid (CID 57351786) is oct-1-en-3-ol;propanoic acid.
What is the SMILES notation for oct-1-en-3-ol;propanoic acid?
The canonical SMILES for oct-1-en-3-ol;propanoic acid is C=CC(O)CCCCC.CCC(=O)O.
What is the InChIKey of oct-1-en-3-ol;propanoic acid?
The InChIKey is XGPRWCKIMRYAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C3H6O2/c1-3-5-6-7-8(9)4-2;1-2-3(4)5/h4,8-9H,2-3,5-7H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of oct-1-en-3-ol;propanoic acid?
oct-1-en-3-ol;propanoic acid has a molecular weight of 202.29 g/mol, XLogP of 2.59, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-en-3-ol;propanoic acid is sourced from PubChem (CID 57351786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).