C20H36O — CID 176937263
(11Z,14Z)-icosa-1,11,14-trien-3-ol (PubChem CID 176937263) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (11Z,14Z)-icosa-1,11,14-trien-3-ol.
| Compound Name | (11Z,14Z)-icosa-1,11,14-trien-3-ol |
|---|---|
| PubChem CID | 176937263 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (11Z,14Z)-icosa-1,11,14-trien-3-ol |
| SMILES | C=CC(O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C20H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)4-2/h4,8-9,11-12,20-21H,2-3,5-7,10,13-19H2,1H3/b9-8-,12-11- |
| InChIKey | NIYYISPXJIKQKO-MURFETPASA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|