C19H20O2 — CID 91366736
1,1-diphenylheptane-2,3-dione (PubChem CID 91366736) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,1-diphenylheptane-2,3-dione.
| Compound Name | 1,1-diphenylheptane-2,3-dione |
|---|---|
| PubChem CID | 91366736 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1,1-diphenylheptane-2,3-dione |
| SMILES | CCCCC(=O)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c1-2-3-14-17(20)19(21)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,18H,2-3,14H2,1H3 |
| InChIKey | PHVIUKAGKQIRHE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|