C18H22O — CID 102526204
(3Z)-4-(1-phenylprop-2-enyl)nona-1,3-dien-5-one (PubChem CID 102526204) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is (3Z)-4-(1-phenylprop-2-enyl)nona-1,3-dien-5-one.
| Compound Name | (3Z)-4-(1-phenylprop-2-enyl)nona-1,3-dien-5-one |
|---|---|
| PubChem CID | 102526204 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (3Z)-4-(1-phenylprop-2-enyl)nona-1,3-dien-5-one |
| SMILES | C=C/C=C(\C(=O)CCCC)C(C=C)c1ccccc1 |
| InChI | InChI=1S/C18H22O/c1-4-7-14-18(19)17(11-5-2)16(6-3)15-12-9-8-10-13-15/h5-6,8-13,16H,2-4,7,14H2,1H3/b17-11- |
| InChIKey | HNHJIXACVWAKRD-BOPFTXTBSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|