C13H20O — CID 102526207
(3Z)-4-but-3-en-2-ylnona-1,3-dien-5-one (PubChem CID 102526207) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3Z)-4-but-3-en-2-ylnona-1,3-dien-5-one.
| Compound Name | (3Z)-4-but-3-en-2-ylnona-1,3-dien-5-one |
|---|---|
| PubChem CID | 102526207 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3Z)-4-but-3-en-2-ylnona-1,3-dien-5-one |
| SMILES | C=C/C=C(\C(=O)CCCC)C(C)C=C |
| InChI | InChI=1S/C13H20O/c1-5-8-10-13(14)12(9-6-2)11(4)7-3/h6-7,9,11H,2-3,5,8,10H2,1,4H3/b12-9- |
| InChIKey | BLFQBDYWXORUEL-XFXZXTDPSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|