C11H20O — CID 15415993
(3S,4S)-3,4-dimethylnon-1-en-5-one (PubChem CID 15415993) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethylnon-1-en-5-one.
| Compound Name | (3S,4S)-3,4-dimethylnon-1-en-5-one |
|---|---|
| PubChem CID | 15415993 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3S,4S)-3,4-dimethylnon-1-en-5-one |
| SMILES | C=C[C@H](C)[C@H](C)C(=O)CCCC |
| InChI | InChI=1S/C11H20O/c1-5-7-8-11(12)10(4)9(3)6-2/h6,9-10H,2,5,7-8H2,1,3-4H3/t9-,10-/m0/s1 |
| InChIKey | XOEDDWRHOIBRGX-UWVGGRQHSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|