C9H16O2 — CID 13254527
ethyl 2,3-dimethylpent-4-enoate (PubChem CID 13254527) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is ethyl 2,3-dimethylpent-4-enoate.
| Compound Name | ethyl 2,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 13254527 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | ethyl 2,3-dimethylpent-4-enoate |
| SMILES | C=CC(C)C(C)C(=O)OCC |
| InChI | InChI=1S/C9H16O2/c1-5-7(3)8(4)9(10)11-6-2/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | CPHJRGIJAQUSAN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|