C17H30O6 — CID 158770655
ethyl (2R,3R)-3-hydroxy-2-methylpent-4-enoate;propan-2-yl (2R,3R)-3-hydroxy-2-methylpent-4-enoate (PubChem CID 158770655) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is ethyl (2R,3R)-3-hydroxy-2-methylpent-4-enoate;propan-2-yl (2R,3R)-3-hydroxy-2-methylpent-4-enoate.
| Compound Name | ethyl (2R,3R)-3-hydroxy-2-methylpent-4-enoate;propan-2-yl (2R,3R)-3-hydroxy-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 158770655 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | ethyl (2R,3R)-3-hydroxy-2-methylpent-4-enoate;propan-2-yl (2R,3R)-3-hydroxy-2-methylpent-4-enoate |
| SMILES | C=C[C@@H](O)[C@@H](C)C(=O)OC(C)C.C=C[C@@H](O)[C@@H](C)C(=O)OCC |
| InChI | InChI=1S/C9H16O3.C8H14O3/c1-5-8(10)7(4)9(11)12-6(2)3;1-4-7(9)6(3)8(10)11-5-2/h5-8,10H,1H2,2-4H3;4,6-7,9H,1,5H2,2-3H3/t7-,8-;6-,7-/m11/s1 |
| InChIKey | IPUYLZZEUWEGSB-VPZONHJHSA-N |
| XLogP | 1.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|