C11H18O2 — CID 21490479
4-but-3-en-2-ylheptane-3,5-dione (PubChem CID 21490479) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 4-but-3-en-2-ylheptane-3,5-dione.
| Compound Name | 4-but-3-en-2-ylheptane-3,5-dione |
|---|---|
| PubChem CID | 21490479 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 4-but-3-en-2-ylheptane-3,5-dione |
| SMILES | C=CC(C)C(C(=O)CC)C(=O)CC |
| InChI | InChI=1S/C11H18O2/c1-5-8(4)11(9(12)6-2)10(13)7-3/h5,8,11H,1,6-7H2,2-4H3 |
| InChIKey | SJRBCCDQTMXQEY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|