C13H24O — CID 132821545
(4R,6S,8S)-4,6,8-trimethyldec-9-en-3-one (PubChem CID 132821545) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (4R,6S,8S)-4,6,8-trimethyldec-9-en-3-one.
| Compound Name | (4R,6S,8S)-4,6,8-trimethyldec-9-en-3-one |
|---|---|
| PubChem CID | 132821545 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (4R,6S,8S)-4,6,8-trimethyldec-9-en-3-one |
| SMILES | C=C[C@@H](C)C[C@H](C)C[C@@H](C)C(=O)CC |
| InChI | InChI=1S/C13H24O/c1-6-10(3)8-11(4)9-12(5)13(14)7-2/h6,10-12H,1,7-9H2,2-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | KUHFHTIRZSUCAH-GRYCIOLGSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|