About carbonic acid;3-methylhex-1-ene
carbonic acid;3-methylhex-1-ene (PubChem CID 161181273) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is carbonic acid;3-methylhex-1-ene.
Molecular Properties
| Compound Name | carbonic acid;3-methylhex-1-ene |
| PubChem CID | 161181273 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | carbonic acid;3-methylhex-1-ene |
| SMILES | C=CC(C)CCC.O=C(O)O |
| InChI | InChI=1S/C7H14.CH2O3/c1-4-6-7(3)5-2;2-1(3)4/h5,7H,2,4,6H2,1,3H3;(H2,2,3,4) |
| InChIKey | USMJEJDAVMUZPH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;3-methylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;3-methylhex-1-ene?
The IUPAC name of carbonic acid;3-methylhex-1-ene (CID 161181273) is carbonic acid;3-methylhex-1-ene.
What is the SMILES notation for carbonic acid;3-methylhex-1-ene?
The canonical SMILES for carbonic acid;3-methylhex-1-ene is C=CC(C)CCC.O=C(O)O.
What is the InChIKey of carbonic acid;3-methylhex-1-ene?
The InChIKey is USMJEJDAVMUZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.CH2O3/c1-4-6-7(3)5-2;2-1(3)4/h5,7H,2,4,6H2,1,3H3;(H2,2,3,4).
What are the key properties of carbonic acid;3-methylhex-1-ene?
carbonic acid;3-methylhex-1-ene has a molecular weight of 160.21 g/mol, XLogP of 2.83, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;3-methylhex-1-ene is sourced from PubChem (CID 161181273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).