C8H14O3 — CID 135047760
(2R,3S)-3-hydroxy-2-propylpent-4-enoic acid (PubChem CID 135047760) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-propylpent-4-enoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-propylpent-4-enoic acid |
|---|---|
| PubChem CID | 135047760 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-propylpent-4-enoic acid |
| SMILES | C=C[C@H](O)C(CCC)C(=O)O |
| InChI | InChI=1S/C8H14O3/c1-3-5-6(8(10)11)7(9)4-2/h4,6-7,9H,2-3,5H2,1H3,(H,10,11)/t6?,7-/m0/s1 |
| InChIKey | YCSAUZUQXKAHRA-MLWJPKLSSA-N |
| XLogP | 1.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|