About acetylene;3-methylhept-1-ene;propane
acetylene;3-methylhept-1-ene;propane (PubChem CID 144520771) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is acetylene;3-methylhept-1-ene;propane.
Molecular Properties
| Compound Name | acetylene;3-methylhept-1-ene;propane |
| PubChem CID | 144520771 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | acetylene;3-methylhept-1-ene;propane |
| SMILES | C#C.C=CC(C)CCCC.CCC |
| InChI | InChI=1S/C8H16.C3H8.C2H2/c1-4-6-7-8(3)5-2;1-3-2;1-2/h5,8H,2,4,6-7H2,1,3H3;3H2,1-2H3;1-2H |
| InChIKey | VIAOKBPIEYWLEN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;3-methylhept-1-ene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;3-methylhept-1-ene;propane?
The IUPAC name of acetylene;3-methylhept-1-ene;propane (CID 144520771) is acetylene;3-methylhept-1-ene;propane.
What is the SMILES notation for acetylene;3-methylhept-1-ene;propane?
The canonical SMILES for acetylene;3-methylhept-1-ene;propane is C#C.C=CC(C)CCCC.CCC.
What is the InChIKey of acetylene;3-methylhept-1-ene;propane?
The InChIKey is VIAOKBPIEYWLEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C3H8.C2H2/c1-4-6-7-8(3)5-2;1-3-2;1-2/h5,8H,2,4,6-7H2,1,3H3;3H2,1-2H3;1-2H.
What are the key properties of acetylene;3-methylhept-1-ene;propane?
acetylene;3-methylhept-1-ene;propane has a molecular weight of 182.35 g/mol, XLogP of 4.66, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;3-methylhept-1-ene;propane is sourced from PubChem (CID 144520771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).