C15H30 — CID 123174555
3,6,8-trimethyldodec-1-ene (PubChem CID 123174555) has the molecular formula C15H30 and a molecular weight of 210.41 g/mol. Its IUPAC name is 3,6,8-trimethyldodec-1-ene.
| Compound Name | 3,6,8-trimethyldodec-1-ene |
|---|---|
| PubChem CID | 123174555 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.41 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 3,6,8-trimethyldodec-1-ene |
| SMILES | C=CC(C)CCC(C)CC(C)CCCC |
| InChI | InChI=1S/C15H30/c1-6-8-9-14(4)12-15(5)11-10-13(3)7-2/h7,13-15H,2,6,8-12H2,1,3-5H3 |
| InChIKey | YYNOVKTZLQASJC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|