C14H26 — CID 173000004
3-methyltrideca-1,7-diene (PubChem CID 173000004) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 3-methyltrideca-1,7-diene.
| Compound Name | 3-methyltrideca-1,7-diene |
|---|---|
| PubChem CID | 173000004 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 3-methyltrideca-1,7-diene |
| SMILES | C=CC(C)CCCC=CCCCCC |
| InChI | InChI=1S/C14H26/c1-4-6-7-8-9-10-11-12-13-14(3)5-2/h5,9-10,14H,2,4,6-8,11-13H2,1,3H3 |
| InChIKey | STHHCCINSUEVFU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|